feat(policy): updateed policy system and added new reaction chains
Reacions chains now contain more information and are broken out in a more detailed fashion.
This commit is contained in:
@@ -6,7 +6,7 @@
|
|||||||
* Proton-Proton chain and the CNO cycle. These policies inherit from ReactionChainPolicy (see
|
* Proton-Proton chain and the CNO cycle. These policies inherit from ReactionChainPolicy (see
|
||||||
* `policy_abstract.h`) and provide a pre-defined set of reactions.
|
* `policy_abstract.h`) and provide a pre-defined set of reactions.
|
||||||
*
|
*
|
||||||
* They are typically used by higher-level NetworkPolicy implementations (e.g., `LowMassMainSequencePolicy`
|
* They are typically used by higher-level NetworkPolicy implementations (e.g., `MainSequencePolicy`
|
||||||
* in `stellar_policy.h`) to compose a complete set of required reactions for a particular
|
* in `stellar_policy.h`) to compose a complete set of required reactions for a particular
|
||||||
* stellar environment.
|
* stellar environment.
|
||||||
*
|
*
|
||||||
@@ -17,258 +17,153 @@
|
|||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "gridfire/policy/policy_abstract.h"
|
#include "gridfire/policy/policy_abstract.h"
|
||||||
|
#include "gridfire/policy/policy_logical.h"
|
||||||
#include "gridfire/reaction/reaction.h"
|
#include "gridfire/reaction/reaction.h"
|
||||||
|
|
||||||
#include "gridfire/reaction/reaclib.h"
|
|
||||||
|
|
||||||
#include "gridfire/exceptions/error_policy.h"
|
|
||||||
|
|
||||||
#include <memory>
|
#include <memory>
|
||||||
|
|
||||||
namespace gridfire::policy {
|
namespace gridfire::policy {
|
||||||
|
|
||||||
/**
|
class TemperatureDependentChainPolicy : public ReactionChainPolicy {
|
||||||
* @class ProtonProtonChainPolicy
|
|
||||||
* @brief A ReactionChainPolicy for the Proton-Proton (PP) chain.
|
|
||||||
*
|
|
||||||
* Encapsulates the set of reactions that constitute the three branches of the PP chain,
|
|
||||||
* which is the primary energy generation mechanism in stars like the Sun.
|
|
||||||
*
|
|
||||||
* @throws gridfire::exceptions::MissingBaseReactionError if a required reaction for the PP chain
|
|
||||||
* is not found in the REACLIB database during construction.
|
|
||||||
*/
|
|
||||||
class ProtonProtonChainPolicy final: public ReactionChainPolicy {
|
|
||||||
public:
|
public:
|
||||||
/**
|
explicit TemperatureDependentChainPolicy(const std::vector<std::string>& reactionIDs);
|
||||||
* @brief Constructs the policy and initializes its reaction set from REACLIB.
|
explicit TemperatureDependentChainPolicy(const std::vector<std::string>& reactionIDs, std::optional<double> minT9);
|
||||||
*/
|
explicit TemperatureDependentChainPolicy(const std::vector<std::string>& reactionIDs, std::optional<double> minT9, std::optional<double> maxT9);
|
||||||
ProtonProtonChainPolicy();
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @brief Returns the set of reactions in the PP chain.
|
|
||||||
* @return const reaction::ReactionSet&
|
|
||||||
*
|
|
||||||
* @par Example
|
|
||||||
* @code
|
|
||||||
* ProtonProtonChainPolicy pp_policy;
|
|
||||||
* const auto& reactions = pp_policy.get_reactions();
|
|
||||||
* std::cout << "PP chain has " << reactions.size() << " reactions." << std::endl;
|
|
||||||
* @endcode
|
|
||||||
*/
|
|
||||||
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override { return m_reactions; }
|
|
||||||
private:
|
|
||||||
std::vector<std::string> m_reactionIDs = {
|
|
||||||
"p(p,e+)d",
|
|
||||||
"d(p,g)he3",
|
|
||||||
"he3(he3,2p)he4",
|
|
||||||
"he4(he3,g)be7",
|
|
||||||
"be7(e-,)li7",
|
|
||||||
"li7(p,a)he4",
|
|
||||||
"be7(p,g)b8",
|
|
||||||
"b8(,e+)be8",
|
|
||||||
"be8(,a)he4"
|
|
||||||
};
|
|
||||||
reaction::ReactionSet m_reactions;
|
|
||||||
};
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @class CNOChainPolicy
|
|
||||||
* @brief A ReactionChainPolicy for the Carbon-Nitrogen-Oxygen (CNO) cycle.
|
|
||||||
*
|
|
||||||
* Encapsulates the reactions of the CNO cycle, a catalytic cycle that is the dominant
|
|
||||||
* source of energy in massive stars.
|
|
||||||
*
|
|
||||||
* @throws gridfire::exceptions::MissingBaseReactionError if a required reaction for the CNO cycle
|
|
||||||
* is not found in the REACLIB database during construction.
|
|
||||||
*/
|
|
||||||
class CNOChainPolicy final: public ReactionChainPolicy {
|
|
||||||
public:
|
|
||||||
/**
|
|
||||||
* @brief Constructs the policy and initializes its reaction set from REACLIB.
|
|
||||||
*/
|
|
||||||
CNOChainPolicy();
|
|
||||||
/**
|
|
||||||
* @brief Returns the set of reactions in the CNO cycle.
|
|
||||||
* @return const reaction::ReactionSet&
|
|
||||||
*
|
|
||||||
* @par Example
|
|
||||||
* @code
|
|
||||||
* CNOChainPolicy cno_policy;
|
|
||||||
* const auto& reactions = cno_policy.get_reactions();
|
|
||||||
* assert(reactions.contains("c12(p,g)n13"));
|
|
||||||
* @endcode
|
|
||||||
*/
|
|
||||||
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override { return m_reactions; }
|
|
||||||
private:
|
|
||||||
std::set<std::string> m_reactionIDs = {
|
|
||||||
"c12(p,g)n13",
|
|
||||||
"n13(,e+)c13",
|
|
||||||
"c13(p,g)n14",
|
|
||||||
"n14(p,g)o15",
|
|
||||||
"o15(,e+)n15",
|
|
||||||
"n15(p,a)c12",
|
|
||||||
|
|
||||||
"n15(p,g)o16",
|
|
||||||
"o16(p,g)f17",
|
|
||||||
"f17(,e+)o17",
|
|
||||||
"o17(p,a)n14",
|
|
||||||
"n14(p,g)o15",
|
|
||||||
"o15(,e+)n15",
|
|
||||||
|
|
||||||
"o17(p,g)f18",
|
|
||||||
"f18(,e+)o18",
|
|
||||||
"o18(p,a)n15",
|
|
||||||
"n15(p,g)o16",
|
|
||||||
"o16(p,g)f17",
|
|
||||||
"f17(,e+)o17",
|
|
||||||
|
|
||||||
"o18(p,g)f19",
|
|
||||||
"f19(p,a)o16",
|
|
||||||
"o16(p,g)f17",
|
|
||||||
"f17(,e+)o17",
|
|
||||||
"o17(p,g)f18",
|
|
||||||
"f18(,e+)o18"
|
|
||||||
};
|
|
||||||
reaction::ReactionSet m_reactions;
|
|
||||||
};
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @class HotCNOChainPolicy
|
|
||||||
* @brief A ReactionChainPolicy for the Hot CNO (HCNO) cycle.
|
|
||||||
*
|
|
||||||
* Encapsulates the reactions of the HCNO cycle, which becomes significant at higher
|
|
||||||
* temperatures and densities than the standard CNO cycle, often in explosive scenarios.
|
|
||||||
*
|
|
||||||
* @throws gridfire::exceptions::MissingBaseReactionError if a required reaction for the HCNO cycle
|
|
||||||
* is not found in the REACLIB database during construction.
|
|
||||||
*/
|
|
||||||
class HotCNOChainPolicy final : public ReactionChainPolicy {
|
|
||||||
public:
|
|
||||||
/**
|
|
||||||
* @brief Constructs the policy and initializes its reaction set from REACLIB.
|
|
||||||
*/
|
|
||||||
HotCNOChainPolicy();
|
|
||||||
/**
|
|
||||||
* @brief Returns the set of reactions in the HCNO cycle.
|
|
||||||
* @return const reaction::ReactionSet&
|
|
||||||
*/
|
|
||||||
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override { return m_reactions; }
|
|
||||||
private:
|
|
||||||
std::set<std::string> m_reactionIDs = {
|
|
||||||
"c12(p,g)n13",
|
|
||||||
"n13(p,g)o14",
|
|
||||||
"o14(,e+)n14",
|
|
||||||
"n14(p,g)o15",
|
|
||||||
"o15(,e+)n15",
|
|
||||||
"n15(p,a)c12",
|
|
||||||
|
|
||||||
"n15(p,g)o16",
|
|
||||||
"o16(p,g)f17",
|
|
||||||
"f17(p,g)ne18",
|
|
||||||
"ne18(,e+)f18",
|
|
||||||
"f18(p,a)o15",
|
|
||||||
"o15(,e+)n15",
|
|
||||||
|
|
||||||
"f18(p,g)ne19",
|
|
||||||
"ne19(,e+)f19",
|
|
||||||
"f19(p,a)o16",
|
|
||||||
"o16(p,g)f17",
|
|
||||||
"f17(p,g)ne18",
|
|
||||||
"ne18(,e+)f18"
|
|
||||||
};
|
|
||||||
|
|
||||||
reaction::ReactionSet m_reactions;
|
|
||||||
};
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @class LowMassMainSequenceReactionChainPolicy
|
|
||||||
* @brief A MultiReactionChainPolicy for low-mass main-sequence stars.
|
|
||||||
*
|
|
||||||
* This policy composes the `ProtonProtonChainPolicy` and `CNOChainPolicy` to represent the
|
|
||||||
* key energy-generating reaction chains active in low-mass stars like the Sun.
|
|
||||||
*/
|
|
||||||
class LowMassMainSequenceReactionChainPolicy final : public MultiReactionChainPolicy {
|
|
||||||
public:
|
|
||||||
/**
|
|
||||||
* @brief Constructs the policy and initializes its child policies.
|
|
||||||
*/
|
|
||||||
LowMassMainSequenceReactionChainPolicy();
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @brief Returns the combined set of reactions from all child policies (PP and CNO).
|
|
||||||
* @return const reaction::ReactionSet&
|
|
||||||
*/
|
|
||||||
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override;
|
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override;
|
||||||
|
[[nodiscard]] bool contains(const std::string& id) const override;
|
||||||
|
[[nodiscard]] bool contains(const reaction::Reaction& reaction) const override;
|
||||||
|
[[nodiscard]] uint64_t hash(uint64_t seed) const override;
|
||||||
|
[[nodiscard]] bool operator==(const ReactionChainPolicy& other) const override;
|
||||||
|
[[nodiscard]] bool operator!=(const ReactionChainPolicy& other) const override;
|
||||||
|
|
||||||
/**
|
[[nodiscard]] bool is_active(double T9) const;
|
||||||
* @brief Returns the vector of child policies.
|
|
||||||
* @return const std::vector<std::unique_ptr<ReactionChainPolicy>>&
|
|
||||||
*
|
|
||||||
* @par Example
|
|
||||||
* @code
|
|
||||||
* LowMassMainSequenceReactionChainPolicy lmms_policy;
|
|
||||||
* const auto& child_policies = lmms_policy.get_chain_policies();
|
|
||||||
* std::cout << "Low-mass policy has " << child_policies.size() << " child policies." << std::endl;
|
|
||||||
* @endcode
|
|
||||||
*/
|
|
||||||
[[nodiscard]] const std::vector<std::unique_ptr<ReactionChainPolicy>>& get_chain_policies() const override;
|
|
||||||
|
|
||||||
|
protected:
|
||||||
|
struct ActiveTempRange {
|
||||||
|
std::optional<double> minT9;
|
||||||
|
std::optional<double> maxT9;
|
||||||
|
};
|
||||||
|
|
||||||
|
ActiveTempRange m_tempRange;
|
||||||
|
std::vector<std::string> m_reactionIDs;
|
||||||
|
reaction::ReactionSet m_reactions;
|
||||||
|
};
|
||||||
|
|
||||||
|
class ProtonProtonIChainPolicy final: public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
ProtonProtonIChainPolicy();
|
||||||
|
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class ProtonProtonIIChainPolicy final: public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
ProtonProtonIIChainPolicy();
|
||||||
|
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class ProtonProtonIIIChainPolicy final: public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
ProtonProtonIIIChainPolicy();
|
||||||
|
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class ProtonProtonChainPolicy final : public MultiReactionChainPolicy {
|
||||||
|
public:
|
||||||
|
ProtonProtonChainPolicy();
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
private:
|
private:
|
||||||
std::vector<std::unique_ptr<ReactionChainPolicy>> m_chain_policies;
|
std::vector<std::unique_ptr<ReactionChainPolicy>> m_chain_policies;
|
||||||
reaction::ReactionSet m_reactions;
|
|
||||||
};
|
};
|
||||||
|
|
||||||
inline ProtonProtonChainPolicy::ProtonProtonChainPolicy() {
|
class CNOIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
const auto& all_reaclib_reactions = reaclib::get_all_reaclib_reactions();
|
public:
|
||||||
|
CNOIChainPolicy();
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
|
||||||
for (const auto& reactionID : m_reactionIDs) {
|
[[nodiscard]] std::string name() const override;
|
||||||
auto reaction = all_reaclib_reactions.get(reactionID);
|
};
|
||||||
if (!reaction) {
|
|
||||||
throw exceptions::MissingBaseReactionError("The Underlying REACLIB reaction set is missing the reaction " + std::string(reactionID) + " needed for the proton-proton chain. This indicates that there is an issue with the GridFire binary you are using. Please try to recompile and if that fails please report this issue to the developers.");
|
|
||||||
}
|
|
||||||
m_reactions.add_reaction(reaction.value()->clone());
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
inline CNOChainPolicy::CNOChainPolicy() {
|
class CNOIIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
const auto& all_reaclib_reactions = reaclib::get_all_reaclib_reactions();
|
public:
|
||||||
for (const auto& reactionID : m_reactionIDs) {
|
CNOIIChainPolicy();
|
||||||
auto reaction = all_reaclib_reactions.get(reactionID);
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
if (!reaction) {
|
|
||||||
throw exceptions::MissingBaseReactionError("The Underlying REACLIB reaction set is missing the reaction " + std::string(reactionID) + " needed for the CNO cycle. This indicates that there is an issue with the GridFire binary you are using. Please try to recompile and if that fails please report this issue to the developers.");
|
|
||||||
}
|
|
||||||
m_reactions.add_reaction(reaction.value()->clone());
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
inline HotCNOChainPolicy::HotCNOChainPolicy() {
|
[[nodiscard]] std::string name() const override;
|
||||||
const auto& all_reaclib_reactions = reaclib::get_all_reaclib_reactions();
|
};
|
||||||
for (const auto& reactionID : m_reactionIDs) {
|
|
||||||
auto reaction = all_reaclib_reactions.get(reactionID);
|
class CNOIIIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
if (!reaction) {
|
public:
|
||||||
throw exceptions::MissingBaseReactionError("The Underlying REACLIB reaction set is missing the reaction " + std::string(reactionID) + " needed for the Hot CNO cycle. This indicates that there is an issue with the GridFire binary you are using. Please try to recompile and if that fails please report this issue to the developers.");
|
CNOIIIChainPolicy();
|
||||||
}
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
m_reactions.add_reaction(reaction.value()->clone());
|
|
||||||
}
|
[[nodiscard]] std::string name() const override;
|
||||||
}
|
};
|
||||||
|
|
||||||
|
class CNOIVChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
inline LowMassMainSequenceReactionChainPolicy::LowMassMainSequenceReactionChainPolicy() {
|
public:
|
||||||
m_chain_policies.emplace_back(std::make_unique<ProtonProtonChainPolicy>());
|
CNOIVChainPolicy();
|
||||||
m_chain_policies.emplace_back(std::make_unique<CNOChainPolicy>());
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
for (const auto& policy_ptr : m_chain_policies) {
|
|
||||||
m_reactions.extend(policy_ptr->get_reactions());
|
[[nodiscard]] std::string name() const override;
|
||||||
}
|
};
|
||||||
}
|
|
||||||
|
class CNOChainPolicy final : public MultiReactionChainPolicy {
|
||||||
inline const reaction::ReactionSet & LowMassMainSequenceReactionChainPolicy::get_reactions() const {
|
public:
|
||||||
return m_reactions;
|
CNOChainPolicy();
|
||||||
}
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
inline const std::vector<std::unique_ptr<ReactionChainPolicy>>& LowMassMainSequenceReactionChainPolicy::get_chain_policies() const {
|
|
||||||
return m_chain_policies;
|
class HotCNOIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
}
|
public:
|
||||||
|
HotCNOIChainPolicy();
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class HotCNOIIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
HotCNOIIChainPolicy();
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class HotCNOIIIChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
HotCNOIIIChainPolicy();
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class HotCNOChainPolicy final : public MultiReactionChainPolicy {
|
||||||
|
public:
|
||||||
|
HotCNOChainPolicy();
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
class TripleAlphaChainPolicy final : public TemperatureDependentChainPolicy {
|
||||||
|
public:
|
||||||
|
TripleAlphaChainPolicy();
|
||||||
|
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
class MainSequenceReactionChainPolicy final : public MultiReactionChainPolicy {
|
||||||
|
public:
|
||||||
|
MainSequenceReactionChainPolicy();
|
||||||
|
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
|
||||||
|
};
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -22,7 +22,6 @@
|
|||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include "fourdst/composition/atomicSpecies.h"
|
#include "fourdst/composition/atomicSpecies.h"
|
||||||
#include "gridfire/engine/types/building.h"
|
|
||||||
#include "gridfire/reaction/reaction.h"
|
#include "gridfire/reaction/reaction.h"
|
||||||
#include "gridfire/engine/engine_abstract.h"
|
#include "gridfire/engine/engine_abstract.h"
|
||||||
|
|
||||||
@@ -57,7 +56,7 @@ namespace gridfire::policy {
|
|||||||
* - A constructor method that returns a fully constructed DynamicEngine (or view stack) built
|
* - A constructor method that returns a fully constructed DynamicEngine (or view stack) built
|
||||||
* to satisfy the policy.
|
* to satisfy the policy.
|
||||||
*
|
*
|
||||||
* Concrete implementations include `LowMassMainSequencePolicy` (see `stellar_policy.h`) and may
|
* Concrete implementations include `MainSequencePolicy` (see `stellar_policy.h`) and may
|
||||||
* throw policy-specific exceptions during construction (for example when required reactions or
|
* throw policy-specific exceptions during construction (for example when required reactions or
|
||||||
* species are missing).
|
* species are missing).
|
||||||
*
|
*
|
||||||
@@ -78,7 +77,7 @@ namespace gridfire::policy {
|
|||||||
/**
|
/**
|
||||||
* @brief Human-readable name for the policy.
|
* @brief Human-readable name for the policy.
|
||||||
*
|
*
|
||||||
* @return a std::string identifying the policy implementation (e.g. "LowMassMainSequencePolicy").
|
* @return a std::string identifying the policy implementation (e.g. "MainSequencePolicy").
|
||||||
*
|
*
|
||||||
* @par Example
|
* @par Example
|
||||||
* @code
|
* @code
|
||||||
@@ -103,7 +102,7 @@ namespace gridfire::policy {
|
|||||||
* for (const auto &s : seeds) { std::cout << s.name() << std::endl; }
|
* for (const auto &s : seeds) { std::cout << s.name() << std::endl; }
|
||||||
* @endcode
|
* @endcode
|
||||||
*/
|
*/
|
||||||
[[nodiscard]] virtual const std::set<fourdst::atomic::Species> get_seed_species() const = 0;
|
[[nodiscard]] virtual const std::set<fourdst::atomic::Species>& get_seed_species() const = 0;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief Returns the set of seed reactions the policy requires.
|
* @brief Returns the set of seed reactions the policy requires.
|
||||||
@@ -114,9 +113,9 @@ namespace gridfire::policy {
|
|||||||
*
|
*
|
||||||
* @par Example
|
* @par Example
|
||||||
* @code
|
* @code
|
||||||
* const reaction::ReactionSet &reacs = policy.get_seed_reactions();
|
* const reaction::ReactionSet &reactions = policy.get_seed_reactions();
|
||||||
* // inspect reaction IDs or count
|
* // inspect reaction IDs or count
|
||||||
* std::cout << "Policy requires " << reacs.size() << " reactions" << std::endl;
|
* std::cout << "Policy requires " << reactions.size() << " reactions" << std::endl;
|
||||||
* @endcode
|
* @endcode
|
||||||
*/
|
*/
|
||||||
[[nodiscard]] virtual const reaction::ReactionSet& get_seed_reactions() const = 0;
|
[[nodiscard]] virtual const reaction::ReactionSet& get_seed_reactions() const = 0;
|
||||||
@@ -170,7 +169,7 @@ namespace gridfire::policy {
|
|||||||
* @par Example
|
* @par Example
|
||||||
* @code
|
* @code
|
||||||
* ProtonProtonChainPolicy pp;
|
* ProtonProtonChainPolicy pp;
|
||||||
* const auto &reacs = pp.get_reactions();
|
* const gridfire::reaction::ReactionSet& reactions = pp.get_reactions();
|
||||||
* @endcode
|
* @endcode
|
||||||
*
|
*
|
||||||
* @note Concrete implementations may throw exceptions on construction if the underlying reaction
|
* @note Concrete implementations may throw exceptions on construction if the underlying reaction
|
||||||
@@ -195,28 +194,23 @@ namespace gridfire::policy {
|
|||||||
* at construction time if the required reactions cannot be found in the base reaction set.
|
* at construction time if the required reactions cannot be found in the base reaction set.
|
||||||
*/
|
*/
|
||||||
[[nodiscard]] virtual const reaction::ReactionSet& get_reactions() const = 0;
|
[[nodiscard]] virtual const reaction::ReactionSet& get_reactions() const = 0;
|
||||||
|
|
||||||
|
[[nodiscard]] virtual bool contains(const std::string& id) const = 0;
|
||||||
|
[[nodiscard]] virtual bool contains(const reaction::Reaction& reaction) const = 0;
|
||||||
|
|
||||||
|
[[nodiscard]] virtual std::unique_ptr<ReactionChainPolicy> clone() const = 0;
|
||||||
|
|
||||||
|
[[nodiscard]] virtual std::string name() const = 0;
|
||||||
|
|
||||||
|
[[nodiscard]] virtual uint64_t hash(uint64_t seed) const = 0;
|
||||||
|
|
||||||
|
[[nodiscard]] virtual bool operator==(const ReactionChainPolicy& other) const = 0;
|
||||||
|
[[nodiscard]] virtual bool operator!=(const ReactionChainPolicy& other) const = 0;
|
||||||
|
|
||||||
|
friend std::ostream& operator<<(std::ostream& os, const ReactionChainPolicy& rcp) {
|
||||||
|
os << "(ReactionChainPolicy: " << rcp.name() << ")";
|
||||||
|
return os;
|
||||||
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
/**
|
|
||||||
* @class MultiReactionChainPolicy
|
|
||||||
* @brief A ReactionChainPolicy composed of multiple child ReactionChainPolicy instances.
|
|
||||||
*
|
|
||||||
* Useful for policies that represent a union of several reaction chains (for example the
|
|
||||||
* `LowMassMainSequenceReactionChainPolicy` composes the proton-proton and CNO chains).
|
|
||||||
*
|
|
||||||
* @par Example
|
|
||||||
* @code
|
|
||||||
* LowMassMainSequenceReactionChainPolicy multi;
|
|
||||||
* const auto &chains = multi.get_chain_policies();
|
|
||||||
* for (const auto &ch : chains) { std::cout << ch->get_reactions().size() << " reactions\n"; }
|
|
||||||
* @endcode
|
|
||||||
*/
|
|
||||||
class MultiReactionChainPolicy : public ReactionChainPolicy {
|
|
||||||
public:
|
|
||||||
/**
|
|
||||||
* @brief Returns the vector of child ReactionChainPolicy instances.
|
|
||||||
* @return const std::vector<std::unique_ptr<ReactionChainPolicy>>&
|
|
||||||
*/
|
|
||||||
[[nodiscard]] virtual const std::vector<std::unique_ptr<ReactionChainPolicy>>& get_chain_policies() const = 0;
|
|
||||||
};
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -0,0 +1,51 @@
|
|||||||
|
#pragma once
|
||||||
|
|
||||||
|
#include "gridfire/policy/policy_abstract.h"
|
||||||
|
|
||||||
|
#include <vector>
|
||||||
|
#include <memory>
|
||||||
|
|
||||||
|
namespace gridfire::policy {
|
||||||
|
/**
|
||||||
|
* @class MultiReactionChainPolicy
|
||||||
|
* @brief A ReactionChainPolicy composed of multiple child ReactionChainPolicy instances.
|
||||||
|
*
|
||||||
|
* Useful for policies that represent a union of several reaction chains (for example the
|
||||||
|
* `LowMassMainSequenceReactionChainPolicy` composes the proton-proton and CNO chains).
|
||||||
|
*
|
||||||
|
* @par Example
|
||||||
|
* @code
|
||||||
|
* LowMassMainSequenceReactionChainPolicy multi;
|
||||||
|
* const auto &chains = multi.get_chain_policies();
|
||||||
|
* for (const auto &ch : chains) { std::cout << ch->get_reactions().size() << " reactions\n"; }
|
||||||
|
* @endcode
|
||||||
|
*/
|
||||||
|
class MultiReactionChainPolicy : public ReactionChainPolicy {
|
||||||
|
public:
|
||||||
|
explicit MultiReactionChainPolicy(std::vector<std::unique_ptr<ReactionChainPolicy>>&& chain_policies);
|
||||||
|
|
||||||
|
[[nodiscard]] const std::vector<std::unique_ptr<ReactionChainPolicy>>& get_chain_policies() const;
|
||||||
|
|
||||||
|
[[nodiscard]] const reaction::ReactionSet& get_reactions() const override;
|
||||||
|
|
||||||
|
[[nodiscard]] bool contains(const std::string &id) const override;
|
||||||
|
[[nodiscard]] bool contains(const reaction::Reaction &reaction) const override;
|
||||||
|
|
||||||
|
[[nodiscard]] std::unique_ptr<ReactionChainPolicy> clone() const override;
|
||||||
|
[[nodiscard]] std::string name() const override;
|
||||||
|
[[nodiscard]] uint64_t hash(uint64_t seed) const override;
|
||||||
|
|
||||||
|
[[nodiscard]] bool operator==(const ReactionChainPolicy& other) const override;
|
||||||
|
[[nodiscard]] bool operator!=(const ReactionChainPolicy& other) const override;
|
||||||
|
|
||||||
|
[[nodiscard]] size_t size() const;
|
||||||
|
|
||||||
|
auto begin() { return m_chain_policies.begin(); }
|
||||||
|
[[nodiscard]] auto begin() const { return m_chain_policies.cbegin(); }
|
||||||
|
auto end() { return m_chain_policies.end(); }
|
||||||
|
[[nodiscard]] auto end() const { return m_chain_policies.cend(); }
|
||||||
|
protected:
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> m_chain_policies;
|
||||||
|
reaction::ReactionSet m_reactions;
|
||||||
|
};
|
||||||
|
}
|
||||||
@@ -2,7 +2,7 @@
|
|||||||
* @file stellar_policy.h
|
* @file stellar_policy.h
|
||||||
* @brief High-level concrete NetworkPolicy for specific stellar environments.
|
* @brief High-level concrete NetworkPolicy for specific stellar environments.
|
||||||
*
|
*
|
||||||
* This file defines the `LowMassMainSequencePolicy`, a concrete implementation of the `NetworkPolicy`
|
* This file defines the `MainSequencePolicy`, a concrete implementation of the `NetworkPolicy`
|
||||||
* interface. This policy is designed to construct a reaction network suitable for simulating
|
* interface. This policy is designed to construct a reaction network suitable for simulating
|
||||||
* nucleosynthesis in low-mass main-sequence stars (like the Sun).
|
* nucleosynthesis in low-mass main-sequence stars (like the Sun).
|
||||||
*
|
*
|
||||||
@@ -23,21 +23,16 @@
|
|||||||
#include "gridfire/engine/engine_abstract.h"
|
#include "gridfire/engine/engine_abstract.h"
|
||||||
#include "gridfire/reaction/reaction.h"
|
#include "gridfire/reaction/reaction.h"
|
||||||
|
|
||||||
#include "gridfire/exceptions/error_policy.h"
|
|
||||||
|
|
||||||
#include "fourdst/composition/composition.h"
|
#include "fourdst/composition/composition.h"
|
||||||
#include "fourdst/composition/atomicSpecies.h"
|
#include "fourdst/composition/atomicSpecies.h"
|
||||||
#include "fourdst/composition/exceptions/exceptions_composition.h"
|
|
||||||
#include "gridfire/engine/engine_graph.h"
|
|
||||||
#include "gridfire/engine/views/engine_adaptive.h"
|
|
||||||
#include "gridfire/engine/views/engine_multiscale.h"
|
|
||||||
#include "gridfire/partition/composite/partition_composite.h"
|
#include "gridfire/partition/composite/partition_composite.h"
|
||||||
|
|
||||||
#include "gridfire/policy/chains.h"
|
#include "gridfire/policy/chains.h"
|
||||||
|
|
||||||
namespace gridfire::policy {
|
namespace gridfire::policy {
|
||||||
/**
|
/**
|
||||||
* @class LowMassMainSequencePolicy
|
* @class MainSequencePolicy
|
||||||
* @brief A NetworkPolicy for building reaction networks suitable for low-mass main-sequence stars.
|
* @brief A NetworkPolicy for building reaction networks suitable for low-mass main-sequence stars.
|
||||||
*
|
*
|
||||||
* This policy ensures that a constructed network contains all necessary species and reactions
|
* This policy ensures that a constructed network contains all necessary species and reactions
|
||||||
@@ -62,7 +57,7 @@ namespace gridfire::policy {
|
|||||||
* This policy composes the `ProtonProtonChainPolicy` and `CNOChainPolicy` to define
|
* This policy composes the `ProtonProtonChainPolicy` and `CNOChainPolicy` to define
|
||||||
* the required reactions.
|
* the required reactions.
|
||||||
*/
|
*/
|
||||||
class LowMassMainSequencePolicy final: public NetworkPolicy {
|
class MainSequencePolicy final: public NetworkPolicy {
|
||||||
public:
|
public:
|
||||||
/**
|
/**
|
||||||
* @brief Constructs the policy from an existing composition object.
|
* @brief Constructs the policy from an existing composition object.
|
||||||
@@ -78,7 +73,7 @@ namespace gridfire::policy {
|
|||||||
* LowMassMainSequencePolicy policy(comp);
|
* LowMassMainSequencePolicy policy(comp);
|
||||||
* @endcode
|
* @endcode
|
||||||
*/
|
*/
|
||||||
explicit LowMassMainSequencePolicy(const fourdst::composition::Composition& composition);
|
explicit MainSequencePolicy(const fourdst::composition::Composition& composition);
|
||||||
/**
|
/**
|
||||||
* @brief Constructs the policy from a list of species and their mass fractions.
|
* @brief Constructs the policy from a list of species and their mass fractions.
|
||||||
*
|
*
|
||||||
@@ -96,19 +91,19 @@ namespace gridfire::policy {
|
|||||||
* LowMassMainSequencePolicy policy(species, mass_fractions);
|
* LowMassMainSequencePolicy policy(species, mass_fractions);
|
||||||
* @endcode
|
* @endcode
|
||||||
*/
|
*/
|
||||||
explicit LowMassMainSequencePolicy(std::vector<fourdst::atomic::Species> seed_species, std::vector<double> mass_fractions);
|
explicit MainSequencePolicy(std::vector<fourdst::atomic::Species> seed_species, std::vector<double> mass_fractions);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief Returns the name of the policy.
|
* @brief Returns the name of the policy.
|
||||||
* @return "LowMassMainSequencePolicy"
|
* @return "MainSequencePolicy"
|
||||||
*/
|
*/
|
||||||
[[nodiscard]] std::string name() const override { return "LowMassMainSequencePolicy"; }
|
[[nodiscard]] std::string name() const override { return "MainSequencePolicy"; }
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @brief Returns the set of seed species required by this policy.
|
* @brief Returns the set of seed species required by this policy.
|
||||||
* @return const std::set<fourdst::atomic::Species>&
|
* @return const std::set<fourdst::atomic::Species>&
|
||||||
*/
|
*/
|
||||||
[[nodiscard]] const std::set<fourdst::atomic::Species> get_seed_species() const override { return m_seed_species; }
|
[[nodiscard]] const std::set<fourdst::atomic::Species>& get_seed_species() const override { return m_seed_species; }
|
||||||
/**
|
/**
|
||||||
* @brief Returns the set of seed reactions required by this policy (from the PP and CNO chains).
|
* @brief Returns the set of seed reactions required by this policy (from the PP and CNO chains).
|
||||||
* @return const reaction::ReactionSet&
|
* @return const reaction::ReactionSet&
|
||||||
@@ -159,7 +154,7 @@ namespace gridfire::policy {
|
|||||||
fourdst::atomic::Mg_24
|
fourdst::atomic::Mg_24
|
||||||
};
|
};
|
||||||
|
|
||||||
std::unique_ptr<ReactionChainPolicy> m_reaction_policy = std::make_unique<LowMassMainSequenceReactionChainPolicy>();
|
std::unique_ptr<ReactionChainPolicy> m_reaction_policy = std::make_unique<MainSequenceReactionChainPolicy>();
|
||||||
fourdst::composition::Composition m_initializing_composition;
|
fourdst::composition::Composition m_initializing_composition;
|
||||||
std::unique_ptr<partition::PartitionFunction> m_partition_function;
|
std::unique_ptr<partition::PartitionFunction> m_partition_function;
|
||||||
std::vector<std::unique_ptr<DynamicEngine>> m_network_stack;
|
std::vector<std::unique_ptr<DynamicEngine>> m_network_stack;
|
||||||
@@ -171,95 +166,6 @@ namespace gridfire::policy {
|
|||||||
|
|
||||||
};
|
};
|
||||||
|
|
||||||
inline LowMassMainSequencePolicy::LowMassMainSequencePolicy(const fourdst::composition::Composition& composition) {
|
|
||||||
for (const auto& species : m_seed_species) {
|
|
||||||
if (!composition.hasSpecies(species)) {
|
|
||||||
throw exceptions::MissingSeedSpeciesError("Cannot initialize LowMassMainSequencePolicy: Required Seed species " + std::string(species.name()) + " is missing from the provided composition.");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
m_initializing_composition = composition;
|
|
||||||
m_partition_function = build_partition_function();
|
|
||||||
}
|
|
||||||
|
|
||||||
inline LowMassMainSequencePolicy::LowMassMainSequencePolicy(std::vector<fourdst::atomic::Species> seed_species, std::vector<double> mass_fractions) {
|
|
||||||
for (const auto& species : m_seed_species) {
|
|
||||||
if (std::ranges::find(seed_species, species) == seed_species.end()) {
|
|
||||||
throw exceptions::MissingSeedSpeciesError("Cannot initialize LowMassMainSequencePolicy: Required Seed species " + std::string(species.name()) + " is missing from the provided composition.");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (const auto& [species, x] : std::views::zip(seed_species, mass_fractions)) {
|
|
||||||
m_initializing_composition.registerSpecies(species);
|
|
||||||
m_initializing_composition.setMassFraction(species, x);
|
|
||||||
}
|
|
||||||
|
|
||||||
const bool didFinalize = m_initializing_composition.finalize(true);
|
|
||||||
if (!didFinalize) {
|
|
||||||
throw fourdst::composition::exceptions::CompositionNotFinalizedError("Failed to finalize initial composition for LowMassMainSequencePolicy.");
|
|
||||||
}
|
|
||||||
|
|
||||||
m_partition_function = build_partition_function();
|
|
||||||
}
|
|
||||||
|
|
||||||
inline DynamicEngine& LowMassMainSequencePolicy::construct() {
|
|
||||||
m_network_stack.clear();
|
|
||||||
|
|
||||||
m_network_stack.emplace_back(
|
|
||||||
std::make_unique<GraphEngine>(m_initializing_composition, *m_partition_function, NetworkBuildDepth::ThirdOrder, NetworkConstructionFlags::DEFAULT)
|
|
||||||
);
|
|
||||||
m_network_stack.emplace_back(
|
|
||||||
std::make_unique<MultiscalePartitioningEngineView>(*m_network_stack.back().get())
|
|
||||||
);
|
|
||||||
m_network_stack.emplace_back(
|
|
||||||
std::make_unique<AdaptiveEngineView>(*m_network_stack.back().get())
|
|
||||||
);
|
|
||||||
|
|
||||||
m_status = NetworkPolicyStatus::INITIALIZED_UNVERIFIED;
|
|
||||||
m_status = check_status();
|
|
||||||
|
|
||||||
switch (m_status) {
|
|
||||||
case NetworkPolicyStatus::MISSING_KEY_REACTION:
|
|
||||||
throw exceptions::MissingKeyReactionError("LowMassMainSequencePolicy construction failed: The constructed network is missing key reactions required by the policy.");
|
|
||||||
case NetworkPolicyStatus::MISSING_KEY_SPECIES:
|
|
||||||
throw exceptions::MissingSeedSpeciesError("LowMassMainSequencePolicy construction failed: The constructed network is missing key seed species required by the policy.");
|
|
||||||
case NetworkPolicyStatus::UNINITIALIZED:
|
|
||||||
throw exceptions::PolicyError("LowMassMainSequencePolicy construction failed: The network policy is uninitialized.");
|
|
||||||
case NetworkPolicyStatus::INITIALIZED_UNVERIFIED:
|
|
||||||
throw exceptions::PolicyError("LowMassMainSequencePolicy construction failed: The network policy status could not be verified.");
|
|
||||||
case NetworkPolicyStatus::INITIALIZED_VERIFIED:
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
return *m_network_stack.back();
|
|
||||||
}
|
|
||||||
|
|
||||||
inline std::unique_ptr<partition::PartitionFunction> LowMassMainSequencePolicy::build_partition_function() {
|
|
||||||
using partition::BasePartitionType;
|
|
||||||
const auto partitionFunction = partition::CompositePartitionFunction({
|
|
||||||
BasePartitionType::RauscherThielemann,
|
|
||||||
BasePartitionType::GroundState
|
|
||||||
});
|
|
||||||
return std::make_unique<partition::CompositePartitionFunction>(partitionFunction);
|
|
||||||
}
|
|
||||||
|
|
||||||
inline NetworkPolicyStatus LowMassMainSequencePolicy::getStatus() const {
|
|
||||||
return m_status;
|
|
||||||
}
|
|
||||||
|
|
||||||
inline NetworkPolicyStatus LowMassMainSequencePolicy::check_status() const {
|
|
||||||
for (const auto& species : m_seed_species) {
|
|
||||||
if (!m_initializing_composition.hasSpecies(species)) {
|
|
||||||
return NetworkPolicyStatus::MISSING_KEY_SPECIES;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
const reaction::ReactionSet& baseReactions = m_network_stack.front()->getNetworkReactions();
|
|
||||||
for (const auto& reaction : m_reaction_policy->get_reactions()) {
|
|
||||||
const bool result = baseReactions.contains(*reaction);
|
|
||||||
if (!result) {
|
|
||||||
return NetworkPolicyStatus::MISSING_KEY_REACTION;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return NetworkPolicyStatus::INITIALIZED_VERIFIED;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
}
|
}
|
||||||
@@ -1,6 +1,5 @@
|
|||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include <expected>
|
|
||||||
#include <ranges>
|
#include <ranges>
|
||||||
#include <string_view>
|
#include <string_view>
|
||||||
|
|
||||||
@@ -345,7 +344,7 @@ namespace gridfire::reaction {
|
|||||||
return os;
|
return os;
|
||||||
}
|
}
|
||||||
|
|
||||||
virtual std::optional<std::vector<RateCoefficientSet>> getRateCoefficients() const = 0;
|
[[nodiscard]] virtual std::optional<std::vector<RateCoefficientSet>> getRateCoefficients() const = 0;
|
||||||
|
|
||||||
};
|
};
|
||||||
class ReaclibReaction : public Reaction {
|
class ReaclibReaction : public Reaction {
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
#pragma once
|
#pragma once
|
||||||
|
|
||||||
#include <cstdint>
|
#include <cstdint>
|
||||||
|
#include <functional>
|
||||||
|
|
||||||
#include "gridfire/exceptions/exceptions.h"
|
#include "gridfire/exceptions/exceptions.h"
|
||||||
#include "gridfire/reaction/reaction.h"
|
#include "gridfire/reaction/reaction.h"
|
||||||
@@ -62,4 +63,10 @@ namespace gridfire::utils {
|
|||||||
return splitmix64(h);
|
return splitmix64(h);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
template <typename T>
|
||||||
|
std::size_t hash_combine(std::size_t seed, const T& v) {
|
||||||
|
std::hash<T> hasher;
|
||||||
|
seed ^= hasher(v) + 0x9e3779b9 + (seed << 6) + (seed >> 2);
|
||||||
|
return seed;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -0,0 +1,337 @@
|
|||||||
|
#include "gridfire/policy/policy_abstract.h"
|
||||||
|
#include "gridfire/policy/policy_logical.h"
|
||||||
|
#include "gridfire/policy/chains.h"
|
||||||
|
|
||||||
|
#include "gridfire/exceptions/error_policy.h"
|
||||||
|
|
||||||
|
#include "gridfire/utils/hashing.h"
|
||||||
|
#include "gridfire/reaction/reaclib.h"
|
||||||
|
|
||||||
|
#include "xxhash64.h"
|
||||||
|
|
||||||
|
|
||||||
|
namespace gridfire::policy {
|
||||||
|
TemperatureDependentChainPolicy::TemperatureDependentChainPolicy(
|
||||||
|
const std::vector<std::string>& reactionIDs
|
||||||
|
) : TemperatureDependentChainPolicy(reactionIDs, std::nullopt, std::nullopt) {}
|
||||||
|
|
||||||
|
TemperatureDependentChainPolicy::TemperatureDependentChainPolicy(
|
||||||
|
const std::vector<std::string>& reactionIDs,
|
||||||
|
const std::optional<double> minT9
|
||||||
|
) : TemperatureDependentChainPolicy(reactionIDs, minT9, std::nullopt) {}
|
||||||
|
|
||||||
|
TemperatureDependentChainPolicy::TemperatureDependentChainPolicy(
|
||||||
|
const std::vector<std::string>& reactionIDs,
|
||||||
|
const std::optional<double> minT9,
|
||||||
|
const std::optional<double> maxT9
|
||||||
|
) :
|
||||||
|
m_reactionIDs(reactionIDs)
|
||||||
|
{
|
||||||
|
m_tempRange.minT9 = minT9;
|
||||||
|
m_tempRange.maxT9 = maxT9;
|
||||||
|
|
||||||
|
const auto& all_reaclib_reactions = reaclib::get_all_reaclib_reactions();
|
||||||
|
|
||||||
|
for (const auto& reactionID : m_reactionIDs) {
|
||||||
|
auto reaction = all_reaclib_reactions.get(reactionID);
|
||||||
|
if (!reaction) {
|
||||||
|
throw exceptions::MissingBaseReactionError("The Underlying REACLIB reaction set is missing the reaction " + std::string(reactionID) + " needed for a chain. This indicates that there is an issue with the GridFire binary you are using. Please try to recompile and if that fails please report this issue to the developers.");
|
||||||
|
}
|
||||||
|
m_reactions.add_reaction(reaction.value()->clone());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const reaction::ReactionSet& TemperatureDependentChainPolicy::get_reactions() const {
|
||||||
|
return m_reactions;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool TemperatureDependentChainPolicy::contains(const std::string &id) const {
|
||||||
|
return m_reactions.contains(id);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool TemperatureDependentChainPolicy::contains(const reaction::Reaction &reaction) const {
|
||||||
|
return m_reactions.contains(reaction);
|
||||||
|
}
|
||||||
|
|
||||||
|
uint64_t TemperatureDependentChainPolicy::hash(const uint64_t seed) const {
|
||||||
|
std::vector<size_t> hashes;
|
||||||
|
for (const auto& reaction : m_reactions) {
|
||||||
|
hashes.push_back(reaction->hash(seed));
|
||||||
|
}
|
||||||
|
return XXHash64::hash(hashes.data(), hashes.size(), seed);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool TemperatureDependentChainPolicy::operator==(const ReactionChainPolicy &other) const {
|
||||||
|
return this->hash(0) == other.hash(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool TemperatureDependentChainPolicy::operator!=(const ReactionChainPolicy &other) const {
|
||||||
|
return this->hash(0) != other.hash(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool TemperatureDependentChainPolicy::is_active(const double T9) const {
|
||||||
|
return (!m_tempRange.minT9.has_value() || T9 >= m_tempRange.minT9.value()) &&
|
||||||
|
(!m_tempRange.maxT9.has_value() || T9 <= m_tempRange.maxT9.value());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specific Implementations *
|
||||||
|
**/
|
||||||
|
|
||||||
|
ProtonProtonIChainPolicy::ProtonProtonIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
// Proton-Proton I
|
||||||
|
"p(p,e+)d",
|
||||||
|
"d(p,g)he3",
|
||||||
|
"he3(he3,2p)he4",
|
||||||
|
},0.001) {}
|
||||||
|
|
||||||
|
ProtonProtonIIChainPolicy::ProtonProtonIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"p(p,e+)d",
|
||||||
|
"d(p,g)he3",
|
||||||
|
"he4(he3,g)be7",
|
||||||
|
"be7(e-,)li7",
|
||||||
|
"li7(p,a)he4",
|
||||||
|
}, 0.001) {}
|
||||||
|
|
||||||
|
ProtonProtonIIIChainPolicy::ProtonProtonIIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"p(p,e+)d",
|
||||||
|
"d(p,g)he3",
|
||||||
|
"he4(he3,g)be7",
|
||||||
|
"be7(p,g)b8",
|
||||||
|
"b8(,e+)be8",
|
||||||
|
"be8(,a)he4"
|
||||||
|
}, 0.001) {}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> ProtonProtonIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<ProtonProtonIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string ProtonProtonIChainPolicy::name() const {
|
||||||
|
return "ProtonProtonIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> ProtonProtonIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<ProtonProtonIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string ProtonProtonIIChainPolicy::name() const {
|
||||||
|
return "ProtonProtonIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> ProtonProtonIIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<ProtonProtonIIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string ProtonProtonIIIChainPolicy::name() const {
|
||||||
|
return "ProtonProtonIIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
ProtonProtonChainPolicy::ProtonProtonChainPolicy() :
|
||||||
|
MultiReactionChainPolicy(
|
||||||
|
[]() {
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> chain_policies;
|
||||||
|
chain_policies.push_back(std::make_unique<ProtonProtonIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<ProtonProtonIIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<ProtonProtonIIIChainPolicy>());
|
||||||
|
return chain_policies;
|
||||||
|
}()
|
||||||
|
){}
|
||||||
|
|
||||||
|
std::string ProtonProtonChainPolicy::name() const {
|
||||||
|
return "ProtonProtonChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
CNOIChainPolicy::CNOIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"c12(p,g)n13",
|
||||||
|
"n13(,e+)c13",
|
||||||
|
"c13(p,g)n14",
|
||||||
|
"n14(p,g)o15",
|
||||||
|
"o15(,e+)n15",
|
||||||
|
"n15(p,a)c12",
|
||||||
|
}, 0.001){}
|
||||||
|
|
||||||
|
CNOIIChainPolicy::CNOIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"n15(p,g)o16",
|
||||||
|
"o16(p,g)f17",
|
||||||
|
"f17(,e+)o17",
|
||||||
|
"o17(p,a)n14",
|
||||||
|
"n14(p,g)o15",
|
||||||
|
"o15(,e+)n15",
|
||||||
|
}, 0.001){}
|
||||||
|
|
||||||
|
CNOIIIChainPolicy::CNOIIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"o17(p,g)f18",
|
||||||
|
"f18(,e+)o18",
|
||||||
|
"o18(p,a)n15",
|
||||||
|
"n15(p,g)o16",
|
||||||
|
"o16(p,g)f17",
|
||||||
|
"f17(,e+)o17",
|
||||||
|
}, 0.001){}
|
||||||
|
|
||||||
|
CNOIVChainPolicy::CNOIVChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"o18(p,g)f19",
|
||||||
|
"f19(p,a)o16",
|
||||||
|
"o16(p,g)f17",
|
||||||
|
"f17(,e+)o17",
|
||||||
|
"o17(p,g)f18",
|
||||||
|
"f18(,e+)o18"
|
||||||
|
}, 0.001){}
|
||||||
|
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> CNOIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<CNOIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string CNOIChainPolicy::name() const {
|
||||||
|
return "CNOIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> CNOIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<CNOIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string CNOIIChainPolicy::name() const {
|
||||||
|
return "CNOIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> CNOIIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<CNOIIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string CNOIIIChainPolicy::name() const {
|
||||||
|
return "CNOIIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> CNOIVChainPolicy::clone() const {
|
||||||
|
return std::make_unique<CNOIVChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string CNOIVChainPolicy::name() const {
|
||||||
|
return "CNOIVChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
CNOChainPolicy::CNOChainPolicy() :
|
||||||
|
MultiReactionChainPolicy(
|
||||||
|
[]() {
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> chain_policies;
|
||||||
|
chain_policies.push_back(std::make_unique<CNOIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<CNOIIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<CNOIIIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<CNOIVChainPolicy>());
|
||||||
|
|
||||||
|
return chain_policies;
|
||||||
|
}()
|
||||||
|
){}
|
||||||
|
|
||||||
|
std::string CNOChainPolicy::name() const {
|
||||||
|
return "CNOChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
HotCNOIChainPolicy::HotCNOIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"c12(p,g)n13",
|
||||||
|
"n13(p,g)o14",
|
||||||
|
"o14(,e+)n14",
|
||||||
|
"n14(p,g)o15",
|
||||||
|
"o15(,e+)n15",
|
||||||
|
"n15(p,a)c12",
|
||||||
|
}, 0.1) {}
|
||||||
|
|
||||||
|
HotCNOIIChainPolicy::HotCNOIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"n15(p,g)o16",
|
||||||
|
"o16(p,g)f17",
|
||||||
|
"f17(p,g)ne18",
|
||||||
|
"ne18(,e+)f18",
|
||||||
|
"f18(p,a)o15",
|
||||||
|
"o15(,e+)n15",
|
||||||
|
}, 0.1) {}
|
||||||
|
|
||||||
|
HotCNOIIIChainPolicy::HotCNOIIIChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"f18(p,g)ne19",
|
||||||
|
"ne19(,e+)f19",
|
||||||
|
"f19(p,a)o16",
|
||||||
|
"o16(p,g)f17",
|
||||||
|
"f17(p,g)ne18",
|
||||||
|
"ne18(,e+)f18"
|
||||||
|
}, 0.1) {}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> HotCNOIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<HotCNOIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string HotCNOIChainPolicy::name() const {
|
||||||
|
return "HotCNOIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> HotCNOIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<HotCNOIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string HotCNOIIChainPolicy::name() const {
|
||||||
|
return "HotCNOIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> HotCNOIIIChainPolicy::clone() const {
|
||||||
|
return std::make_unique<HotCNOIIIChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string HotCNOIIIChainPolicy::name() const {
|
||||||
|
return "HotCNOIIIChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
HotCNOChainPolicy::HotCNOChainPolicy()
|
||||||
|
: MultiReactionChainPolicy(
|
||||||
|
[]() {
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> chain_policies;
|
||||||
|
chain_policies.push_back(std::make_unique<HotCNOIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<HotCNOIIChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<HotCNOIIIChainPolicy>());
|
||||||
|
|
||||||
|
return chain_policies;
|
||||||
|
}()
|
||||||
|
){}
|
||||||
|
|
||||||
|
std::string HotCNOChainPolicy::name() const {
|
||||||
|
return "HotCNOChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
TripleAlphaChainPolicy::TripleAlphaChainPolicy()
|
||||||
|
: TemperatureDependentChainPolicy({
|
||||||
|
"he4(he4,a)be8",
|
||||||
|
"be8(he4,g)c12"
|
||||||
|
}, 0.01) {}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> TripleAlphaChainPolicy::clone() const {
|
||||||
|
return std::make_unique<TripleAlphaChainPolicy>(*this);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string TripleAlphaChainPolicy::name() const {
|
||||||
|
return "TripleAlphaChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
MainSequenceReactionChainPolicy::MainSequenceReactionChainPolicy()
|
||||||
|
: MultiReactionChainPolicy(
|
||||||
|
[]() {
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> chain_policies;
|
||||||
|
chain_policies.push_back(std::make_unique<ProtonProtonChainPolicy>());
|
||||||
|
chain_policies.push_back(std::make_unique<CNOChainPolicy>());
|
||||||
|
|
||||||
|
return chain_policies;
|
||||||
|
}()
|
||||||
|
){}
|
||||||
|
|
||||||
|
std::string MainSequenceReactionChainPolicy::name() const {
|
||||||
|
return "MainSequenceReactionChainPolicy";
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|||||||
@@ -0,0 +1,69 @@
|
|||||||
|
#include "gridfire/policy/policy_abstract.h"
|
||||||
|
#include "gridfire/policy/policy_logical.h"
|
||||||
|
|
||||||
|
#include "xxhash64.h"
|
||||||
|
#include "gridfire/utils/hashing.h"
|
||||||
|
|
||||||
|
namespace gridfire::policy {
|
||||||
|
MultiReactionChainPolicy::MultiReactionChainPolicy(
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> &&chain_policies
|
||||||
|
) : m_chain_policies(std::move(chain_policies)) {
|
||||||
|
for (const auto &ch : m_chain_policies) {
|
||||||
|
m_reactions.extend(ch->get_reactions());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const std::vector<std::unique_ptr<ReactionChainPolicy>> & MultiReactionChainPolicy::get_chain_policies() const {
|
||||||
|
return m_chain_policies;
|
||||||
|
}
|
||||||
|
|
||||||
|
const reaction::ReactionSet & MultiReactionChainPolicy::get_reactions() const {
|
||||||
|
return m_reactions;
|
||||||
|
}
|
||||||
|
|
||||||
|
bool MultiReactionChainPolicy::contains(const std::string &id) const {
|
||||||
|
return m_reactions.contains(id);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool MultiReactionChainPolicy::contains(const reaction::Reaction &reaction) const {
|
||||||
|
return m_reactions.contains(reaction);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::unique_ptr<ReactionChainPolicy> MultiReactionChainPolicy::clone() const {
|
||||||
|
return std::make_unique<MultiReactionChainPolicy>(
|
||||||
|
[this]() {
|
||||||
|
std::vector<std::unique_ptr<ReactionChainPolicy>> chain_policies;
|
||||||
|
for (const auto &ch : m_chain_policies) {
|
||||||
|
chain_policies.push_back(ch->clone());
|
||||||
|
}
|
||||||
|
return chain_policies;
|
||||||
|
}()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
std::string MultiReactionChainPolicy::name() const {
|
||||||
|
return "MultiReactionChainPolicy";
|
||||||
|
}
|
||||||
|
|
||||||
|
uint64_t MultiReactionChainPolicy::hash(const uint64_t seed) const {
|
||||||
|
std::vector<size_t> reaction_hashes;
|
||||||
|
for (const auto& reaction : m_reactions) {
|
||||||
|
reaction_hashes.push_back(reaction->hash(seed));
|
||||||
|
}
|
||||||
|
|
||||||
|
return XXHash64::hash(reaction_hashes.data(), reaction_hashes.size(), seed);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool MultiReactionChainPolicy::operator==(const ReactionChainPolicy &other) const {
|
||||||
|
return this->hash(0) == other.hash(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
bool MultiReactionChainPolicy::operator!=(const ReactionChainPolicy &other) const {
|
||||||
|
return this->hash(0) != other.hash(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
size_t MultiReactionChainPolicy::size() const {
|
||||||
|
return m_chain_policies.size();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|||||||
@@ -0,0 +1,101 @@
|
|||||||
|
#include "gridfire/policy/stellar_policy.h"
|
||||||
|
#include "gridfire/policy/policy_abstract.h"
|
||||||
|
#include "gridfire/exceptions/error_policy.h"
|
||||||
|
|
||||||
|
#include "gridfire/engine/engine_abstract.h"
|
||||||
|
#include "gridfire/engine/engine_graph.h"
|
||||||
|
#include "gridfire/engine/views/engine_views.h"
|
||||||
|
|
||||||
|
#include "fourdst/composition/exceptions/exceptions_composition.h"
|
||||||
|
|
||||||
|
namespace gridfire::policy {
|
||||||
|
MainSequencePolicy::MainSequencePolicy(const fourdst::composition::Composition& composition) {
|
||||||
|
for (const auto& species : m_seed_species) {
|
||||||
|
if (!composition.hasSpecies(species)) {
|
||||||
|
throw exceptions::MissingSeedSpeciesError("Cannot initialize MainSequencePolicy: Required Seed species " + std::string(species.name()) + " is missing from the provided composition.");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
m_initializing_composition = composition;
|
||||||
|
m_partition_function = build_partition_function();
|
||||||
|
}
|
||||||
|
|
||||||
|
MainSequencePolicy::MainSequencePolicy(std::vector<fourdst::atomic::Species> seed_species, std::vector<double> mass_fractions) {
|
||||||
|
for (const auto& species : m_seed_species) {
|
||||||
|
if (std::ranges::find(seed_species, species) == seed_species.end()) {
|
||||||
|
throw exceptions::MissingSeedSpeciesError("Cannot initialize MainSequencePolicy: Required Seed species " + std::string(species.name()) + " is missing from the provided composition.");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for (const auto& [species, x] : std::views::zip(seed_species, mass_fractions)) {
|
||||||
|
m_initializing_composition.registerSpecies(species);
|
||||||
|
m_initializing_composition.setMassFraction(species, x);
|
||||||
|
}
|
||||||
|
|
||||||
|
const bool didFinalize = m_initializing_composition.finalize(true);
|
||||||
|
if (!didFinalize) {
|
||||||
|
throw fourdst::composition::exceptions::CompositionNotFinalizedError("Failed to finalize initial composition for MainSequencePolicy.");
|
||||||
|
}
|
||||||
|
|
||||||
|
m_partition_function = build_partition_function();
|
||||||
|
}
|
||||||
|
|
||||||
|
DynamicEngine& MainSequencePolicy::construct() {
|
||||||
|
m_network_stack.clear();
|
||||||
|
|
||||||
|
m_network_stack.emplace_back(
|
||||||
|
std::make_unique<GraphEngine>(m_initializing_composition, *m_partition_function, NetworkBuildDepth::ThirdOrder, NetworkConstructionFlags::DEFAULT)
|
||||||
|
);
|
||||||
|
m_network_stack.emplace_back(
|
||||||
|
std::make_unique<MultiscalePartitioningEngineView>(*m_network_stack.back().get())
|
||||||
|
);
|
||||||
|
m_network_stack.emplace_back(
|
||||||
|
std::make_unique<AdaptiveEngineView>(*m_network_stack.back().get())
|
||||||
|
);
|
||||||
|
|
||||||
|
m_status = NetworkPolicyStatus::INITIALIZED_UNVERIFIED;
|
||||||
|
m_status = check_status();
|
||||||
|
|
||||||
|
switch (m_status) {
|
||||||
|
case NetworkPolicyStatus::MISSING_KEY_REACTION:
|
||||||
|
throw exceptions::MissingKeyReactionError("MainSequencePolicy construction failed: The constructed network is missing key reactions required by the policy.");
|
||||||
|
case NetworkPolicyStatus::MISSING_KEY_SPECIES:
|
||||||
|
throw exceptions::MissingSeedSpeciesError("MainSequencePolicy construction failed: The constructed network is missing key seed species required by the policy.");
|
||||||
|
case NetworkPolicyStatus::UNINITIALIZED:
|
||||||
|
throw exceptions::PolicyError("MainSequencePolicy construction failed: The network policy is uninitialized.");
|
||||||
|
case NetworkPolicyStatus::INITIALIZED_UNVERIFIED:
|
||||||
|
throw exceptions::PolicyError("MainSequencePolicy construction failed: The network policy status could not be verified.");
|
||||||
|
case NetworkPolicyStatus::INITIALIZED_VERIFIED:
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
return *m_network_stack.back();
|
||||||
|
}
|
||||||
|
|
||||||
|
inline std::unique_ptr<partition::PartitionFunction> MainSequencePolicy::build_partition_function() {
|
||||||
|
using partition::BasePartitionType;
|
||||||
|
const auto partitionFunction = partition::CompositePartitionFunction({
|
||||||
|
BasePartitionType::RauscherThielemann,
|
||||||
|
BasePartitionType::GroundState
|
||||||
|
});
|
||||||
|
return std::make_unique<partition::CompositePartitionFunction>(partitionFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
inline NetworkPolicyStatus MainSequencePolicy::getStatus() const {
|
||||||
|
return m_status;
|
||||||
|
}
|
||||||
|
|
||||||
|
inline NetworkPolicyStatus MainSequencePolicy::check_status() const {
|
||||||
|
for (const auto& species : m_seed_species) {
|
||||||
|
if (!m_initializing_composition.hasSpecies(species)) {
|
||||||
|
return NetworkPolicyStatus::MISSING_KEY_SPECIES;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
const reaction::ReactionSet& baseReactions = m_network_stack.front()->getNetworkReactions();
|
||||||
|
for (const auto& reaction : m_reaction_policy->get_reactions()) {
|
||||||
|
const bool result = baseReactions.contains(*reaction);
|
||||||
|
if (!result) {
|
||||||
|
return NetworkPolicyStatus::MISSING_KEY_REACTION;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return NetworkPolicyStatus::INITIALIZED_VERIFIED;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -24,6 +24,9 @@ gridfire_sources = files(
|
|||||||
'lib/partition/partition_rauscher_thielemann.cpp',
|
'lib/partition/partition_rauscher_thielemann.cpp',
|
||||||
'lib/partition/partition_ground.cpp',
|
'lib/partition/partition_ground.cpp',
|
||||||
'lib/partition/composite/partition_composite.cpp',
|
'lib/partition/composite/partition_composite.cpp',
|
||||||
|
'lib/policy/chains.cpp',
|
||||||
|
'lib/policy/policy_logical.cpp',
|
||||||
|
'lib/policy/stellar_policy.cpp',
|
||||||
'lib/utils/logging.cpp',
|
'lib/utils/logging.cpp',
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|||||||
Reference in New Issue
Block a user